| Melting point: |
-60℃ |
| Boiling point: |
244 °C/28 mmHg |
| Density |
0.98 |
| refractive index |
1.44 |
| Flash point: |
Not applicable |
| storage temp. |
−20°C |
| solubility |
DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml |
| form |
clear liquid |
| color |
Colorless to Light yellow to Light orange |
| BRN |
1806732 |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
1S/C21H38O6/c1-4-7-10-13-19(22)25-16-18(27-21(24)15-12-9-6-3)17-26-20(23)14-11-8-5-2/h18H,4-17H2,1-3H3 |
| InChIKey |
MAYCICSNZYXLHB-UHFFFAOYSA-N |
| SMILES |
CCCCCC(=O)OCC(COC(=O)CCCCC)OC(=O)CCCCC |
| LogP |
6.330 (est) |
| CAS DataBase Reference |
621-70-5 |
| EPA Substance Registry System |
Hexanoic acid, 1,2,3-propanetriyl ester (621-70-5) |
