L-Homophenylalanine ethyl ester hydrochloride
- Product NameL-Homophenylalanine ethyl ester hydrochloride
- CAS90891-21-7
- CBNumberCB0761518
- MFC12H17NO2.ClH
- MW243.73
- EINECS1308068-626-2
- MDL NumberMFCD00190691
- MOL File90891-21-7.mol
Chemical Properties
| Melting point: | 159-163 °C(lit.) |
| alpha | 26 º (c=1,CHCl3) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Powder |
| color | White to off-white to tan |
| optical activity | [α]20/D +26°, c = 1 in chloroform |
| Major Application | peptide synthesis |
| InChI | 1S/C12H17NO2.ClH/c1-2-15-12(14)11(13)9-8-10-6-4-3-5-7-10;/h3-7,11H,2,8-9,13H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | PTFKZMFFSIYCOV-MERQFXBCSA-N |
| SMILES | Cl[H].CCOC(=O)[C@@H](N)CCc1ccccc1 |
| CAS DataBase Reference | 90891-21-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |