![Calix[6]arene Structure](https://www.chemicalbook.com/CAS/GIF/96107-95-8.gif)
Calix[6]arene
- Product NameCalix[6]arene
- CAS96107-95-8
- CBNumberCB0704430
- MFC42H36O6
- MW636.73
- MDL NumberMFCD00143083
- MOL File96107-95-8.mol
Chemical Properties
| Melting point: | 395 °C(lit.) |
| Boiling point: | 630.34°C (rough estimate) |
| Density | 1.302 |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C, stored under nitrogen |
| pka | 9.20±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | 0.180g/100g of water @ 25°C. Miscible with alcohol, chloroform, ether, carbon disulfide, acetone, oils, carbon tetrachloride and glacial acetic acid. |
| BRN | 4345238 |
| InChIKey | JLSWUKWFQCVKCL-UHFFFAOYSA-N |
| SMILES | C12=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)CC1=C(O)C(=CC=C1)C2 |
| CAS DataBase Reference | 96107-95-8 |
Safety
| Symbol(GHS) |
  GHS07,GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H335-H315-H319-H360 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P501a-P201-P202-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P308+P313-P405-P501 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2907.29.9000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|