4-Fluoro-2-(trifluoromethyl)benzoyl chloride
- Product Name4-Fluoro-2-(trifluoromethyl)benzoyl chloride
- CAS189807-21-4
- CBNumberCB0703064
- MFC8H3ClF4O
- MW226.56
- MDL NumberMFCD00061158
- MOL File189807-21-4.mol
Chemical Properties
| Boiling point: | 157 °C (lit.) |
| Density | 1.495 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | Not miscible in water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C8H3ClF4O/c9-7(14)5-2-1-4(10)3-6(5)8(11,12)13/h1-3H |
| InChIKey | OEYHURRIOWWRMD-UHFFFAOYSA-N |
| SMILES | Fc1ccc(C(Cl)=O)c(c1)C(F)(F)F |
| CAS DataBase Reference | 189807-21-4(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 23-26-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2916399090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|