![Thieno[2,3-b]thiophene Structure](https://www.chemicalbook.com/CAS/GIF/250-84-0.gif)
Thieno[2,3-b]thiophene
- Product NameThieno[2,3-b]thiophene
- CAS250-84-0
- CBNumberCB0691149
- MFC6H4S2
- MW140.23
- MDL NumberMFCD02824126
- MOL File250-84-0.mol
Chemical Properties
| Melting point: | 7 °C |
| Boiling point: | 226 °C |
| Density | 1.34 |
| refractive index | 1.67 |
| Flash point: | 93 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C6H4S2/c1-3-7-6-5(1)2-4-8-6/h1-4H |
| InChIKey | YHBTXTFFTYXOFV-UHFFFAOYSA-N |
| SMILES | C12SC=CC=1C=CS2 |
| LogP | 3.043 (est) |
| CAS DataBase Reference | 250-84-0 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| RIDADR | UN 3334 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2934999090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|