4-Chloro-6-nitro-m-cresol
- Product Name4-Chloro-6-nitro-m-cresol
- CAS7147-89-9
- CBNumberCB0679189
- MFC7H6ClNO3
- MW187.58
- EINECS230-461-5
- MDL NumberMFCD00007114
- MOL File7147-89-9.mol
Chemical Properties
| Melting point: | 132-134 °C(lit.) |
| Boiling point: | 276.7±35.0 °C(Predicted) |
| Density | 1.4219 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | RT, stored under nitrogen |
| pka | 6.51±0.27(Predicted) |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| Henry's Law Constant | 3.6×10-1 mol/(m3Pa) at 25℃, Schwarzenbach et al. (1988) |
| InChI | 1S/C7H6ClNO3/c1-4-2-7(10)6(9(11)12)3-5(4)8/h2-3,10H,1H3 |
| InChIKey | JBMGJOKJUYGIJH-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c(cc1Cl)[N+]([O-])=O |
| CAS DataBase Reference | 7147-89-9(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4-chloro-5-methyl-2-nitro- (7147-89-9) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2908999090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|