6-Chloro-3-formylchromone
- Product Name6-Chloro-3-formylchromone
- CAS42248-31-7
- CBNumberCB0472980
- MFC10H5ClO3
- MW208.6
- MDL NumberMFCD00139138
- MOL File42248-31-7.mol
Chemical Properties
| Melting point: | 166-168 °C(lit.) |
| Boiling point: | 351.9±42.0 °C(Predicted) |
| Density | 1.561±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C10H5ClO3/c11-7-1-2-9-8(3-7)10(13)6(4-12)5-14-9/h1-5H |
| InChIKey | LIGLNCRTMDRUAO-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=C(Cl)C=C2C(=O)C=1C=O |
| CAS DataBase Reference | 42248-31-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 37/39-26 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 2932999099 | |||||||||
| NFPA 704: |
|