Tocopheryl acetate
- Product NameTocopheryl acetate
- CAS7695-91-2
- CBNumberCB0459903
- MFC31H52O3
- MW472.74
- EINECS231-710-0
- MDL NumberMFCD00072042
- MOL File7695-91-2.mol
Chemical Properties
| Melting point: | -28°C |
| Boiling point: | 224 °C0.3 mm Hg(lit.) |
| Density | 0.96 g/mL at 20 °C (lit.) |
| vapor density | 16.3 (vs air) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, freely soluble in acetone, in anhydrous ethanol and in fatty oils. |
| form | Viscous Liquid |
| Specific Gravity | 0.962 (20/4℃) |
| color | Clear yellow viscous liquid |
| Odor | Odorless |
| biological source | synthetic (organic) |
| Water Solubility | Immiscible with water. |
| Sensitive | Air & Light Sensitive |
| Merck | 14,9495 |
| BRN | 97512 |
| Major Application | pharmaceutical (small molecule) vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions | SKIN CONDITIONING ANTIOXIDANT |
| InChI | 1S/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/m1/s1 |
| InChIKey | ZAKOWWREFLAJOT-CEFNRUSXSA-N |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(OC(C)=O)c(C)c(C)c2O1 |
| LogP | 12.260 (est) |
| CAS DataBase Reference | 7695-91-2(CAS DataBase Reference) |
| NIST Chemistry Reference | (+)-«ALPHA»-tocopherol acetate(7695-91-2) |
| EPA Substance Registry System | 2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-, acetate (7695-91-2) |
Safety
| Symbol(GHS) |
   GHS02,GHS06,GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H413 | |||||||||
| PPE | Eyeshields, Gloves | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 1 | |||||||||
| RTECS | GA8747000 | |||||||||
| F | 8-10-23 | |||||||||
| Autoignition Temperature | 303°C | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29362800 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|