Myxothiazol
- Product NameMyxothiazol
- CAS76706-55-3
- CBNumberCB0453976
- MFC25H33N3O3S2
- MW487.68
- MDL NumberMFCD00043397
- MOL File76706-55-3.mol
Chemical Properties
| Boiling point: | 679.6±65.0 °C(Predicted) |
| Density | 1.158±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | chloroform: soluble9.80 - 10.20mg/mL, clear, colorless to yellow |
| form | Solid |
| pka | 14.07±0.50(Predicted) |
| color | White to off-white |
| biological source | Myxococcus fulvus Mx f85 |
| InChIKey | XKTFQMCPGMTBMD-ZDBABOMLSA-N |
| SMILES | CO[C@@H](\C=C\c1csc(n1)-c2csc(n2)[C@@H](C)\C=C\C=C\C(C)C)[C@@H](C)\C(OC)=C\C(N)=O |
Safety
| Symbol(GHS) |
 GHS06 |
| Signal word | Danger |
| Hazard statements | H300 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | T+ |
| Risk Statements | 28 |
| Safety Statements | 28-36/37-45 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | QH7580000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class |
6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |