Bis(trimethoxysilylpropyl)amine
- Product NameBis(trimethoxysilylpropyl)amine
- CAS82985-35-1
- CBNumberCB0348409
- MFC12H31NO6Si2
- MW341.55
- EINECS403-480-3
- MDL NumberMFCD00191835
- MOL File82985-35-1.mol
Chemical Properties
| Melting point: | <0°C |
| Boiling point: | 152 °C/4 mmHg |
| Density | 1.05 |
| vapor pressure | 0-12790Pa at 20-25℃ |
| refractive index | 1.43 |
| Flash point: | >230 °F |
| storage temp. | 2-8°C(protect from light) |
| form | clear liquid |
| pka | 10.78±0.19(Predicted) |
| Specific Gravity | 1.04 |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 34-1000g/L at 20℃ |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 9569446 |
| InChI | 1S/C12H31NO6Si2/c1-14-20(15-2,16-3)11-7-9-13-10-8-12-21(17-4,18-5)19-6/h13H,7-12H2,1-6H3 |
| InChIKey | TZZGHGKTHXIOMN-UHFFFAOYSA-N |
| SMILES | CO[Si](CCCNCCC[Si](OC)(OC)OC)(OC)OC |
| LogP | -4-0.2 at 20℃ |
| CAS DataBase Reference | 82985-35-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanamine, 3-(trimethoxysilyl)-N-[3-(trimethoxysilyl)propyl]- (82985-35-1) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H318 | |||||||||
| Precautionary statements | P280-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/22-36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | UN 3082 9/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | TX2101000 | |||||||||
| F | 3-10 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Eye Dam. 1 | |||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|