Formic acid triethylamine complex 5:2
- Product NameFormic acid triethylamine complex 5:2
- CAS15077-13-1
- CBNumberCB0322294
- MFC7H17NO2
- MW147.22
- MDL NumberMFCD00040600
- MOL File15077-13-1.mol
Chemical Properties
| Melting point: | 15 °C |
| Boiling point: | 194 °C |
| Density | 1.04 |
| refractive index | 1.43 |
| Flash point: | 110 °C |
| storage temp. | Store below +30°C. |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 4150472 |
| InChI | InChI=1S/C6H15N.CH2O2/c1-4-7(5-2)6-3;2-1-3/h4-6H2,1-3H3;1H,(H,2,3) |
| InChIKey | NLOIHFJXBNFDSF-UHFFFAOYSA-N |
| SMILES | C(=O)O.N(CC)(CC)CC |
| CAS DataBase Reference | 15077-13-1 |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 23-26-45 | |||||||||
| RIDADR | UN 3265 8 / PGII | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2942 00 00 | |||||||||
| HazardClass | 8 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|