Fmoc-D-Trp(Boc)-OH
- Product NameFmoc-D-Trp(Boc)-OH
- CAS163619-04-3
- CBNumberCB0282369
- MFC31H30N2O6
- MW526.58
- MDL NumberMFCD00153367
- MOL File163619-04-3.mol
Chemical Properties
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.71±0.10(Predicted) |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 7062970 |
| Major Application | peptide synthesis |
| InChIKey | ADOHASQZJSJZBT-AREMUKBSSA-N |
| SMILES | C(O)(=O)[C@@H](CC1C2=C(C=CC=C2)N(C(OC(C)(C)C)=O)C=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 163619-04-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P280-P261 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Safety Statements | 22-24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| HS Code | 29339900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|