WS 12
- Product NameWS 12
- CAS68489-09-8
- CBNumberCB02455758
- MFC18H27NO2
- MW289.41
- EINECS700-232-9
- MDL NumberMFCD11100191
- MOL File68489-09-8.mol
Chemical Properties
| Boiling point: | 447.8±28.0 °C(Predicted) |
| Density | 1.029±0.06 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-50℃ |
| FEMA | 4681 | (1R,2S,5R)-N-(4-METHOXYPHENYL)-5-METHYL-2-(1-METHYLETHYL)CYCLOHEXANECARBOXAMIDE |
| storage temp. | -20°C |
| solubility | DMSO: >20mg/mL |
| form | White to off-white powder. |
| pka | 14.18±0.70(Predicted) |
| color | white to off-white |
| Odor | at 100.00 %. cool minty |
| Odor Type | minty |
| JECFA Number | 2079 |
| InChI | 1S/C18H27NO2/c1-12(2)16-10-5-13(3)11-17(16)18(20)19-14-6-8-15(21-4)9-7-14/h6-9,12-13,16-17H,5,10-11H2,1-4H3,(H,19,20)/t13-,16,17/m1/s1 |
| InChIKey | HNSGVPAAXJJOPQ-XOKHGSTOSA-N |
| SMILES | COc1ccc(NC(=O)C2C[C@H](C)CC[C@H]2C(C)C)cc1 |
| LogP | 3.95 at 22℃ and pH7.7 |
| CAS DataBase Reference | 68489-09-8 |
Safety
| Symbol(GHS) |
 GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50 |
| Safety Statements | 53-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications |
Aquatic Acute 1 Aquatic Chronic 1 |
| REACH Registrations | Active |