2,2'-Bipyridine-6,6'-dicarboxylic acid
- Product Name2,2'-Bipyridine-6,6'-dicarboxylic acid
- CAS4479-74-7
- CBNumberCB02455420
- MFC12H8N2O4
- MW244.2
- EINECS806-930-0
- MDL NumberMFCD11042476
- MOL File4479-74-7.mol
Chemical Properties
| Melting point: | 286℃ |
| Boiling point: | 568.1±50.0 °C(Predicted) |
| Density | 1.469 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | powder to crystal |
| pka | 2.97±0.10(Predicted) |
| color | White to Almost white |
| λmax | 288nm(H2O)(lit.) |
| InChI | InChI=1S/C12H8N2O4/c15-11(16)9-5-1-3-7(13-9)8-4-2-6-10(14-8)12(17)18/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | DASAXWLMIWDYLQ-UHFFFAOYSA-N |
| SMILES | C1(C2=NC(C(O)=O)=CC=C2)=NC(C(O)=O)=CC=C1 |
| CAS DataBase Reference | 4479-74-7 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338 | |||||||||
| HS Code | 2933399090 | |||||||||
| NFPA 704: |
|