4-(N,N-Dimethylaminocarbonyl)phenylboronic acid
- Product Name4-(N,N-Dimethylaminocarbonyl)phenylboronic acid
- CAS405520-68-5
- CBNumberCB0244503
- MFC9H12BNO3
- MW193.01
- MDL NumberMFCD02258943
- MOL File405520-68-5.mol
Chemical Properties
| Melting point: | 141-145 °C |
| Boiling point: | 407.4±47.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 7.76±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C9H12BNO3/c1-11(2)9(12)7-3-5-8(6-4-7)10(13)14/h3-6,13-14H,1-2H3 |
| InChIKey | QJYYVSIRDJVQJW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C(N(C)C)=O)C=C1)(O)O |
| CAS DataBase Reference | 405520-68-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | 1 | |||||||||
| Hazard Note | Irritant/Keep Cold | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|