Homopiperonylamine
- Product NameHomopiperonylamine
- CAS1484-85-1
- CBNumberCB0129482
- MFC9H11NO2
- MW165.19
- EINECS216-060-8
- MDL NumberMFCD00060509
- MOL File1484-85-1.mol
Chemical Properties
| Melting point: | 114 °C |
| Boiling point: | 166 °C/20 mmHg |
| Density | 1.18 |
| RTECS | SH9670000 |
| refractive index | 1.5620 (estimate) |
| Flash point: | 130 °C |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform, Methanol |
| form | clear liquid |
| pka | 9.90±0.10(Predicted) |
| color | Colorless to Yellow to Orange |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C9H11NO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3-4,6,10H2 |
| InChIKey | RRIRDPSOCUCGBV-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(CCN)C=C2OC1 |
| CAS DataBase Reference | 1484-85-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 41 | |||||||||
| Safety Statements | 26-39-24/25 | |||||||||
| RIDADR | UN2735 | |||||||||
| WGK Germany | WGK 3 | |||||||||
| HazardClass | 8 | |||||||||
| HS Code | 2921300090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Dam. 1 | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|