Ammonium citrate dibasic
- Product NameAmmonium citrate dibasic
- CAS3012-65-5
- CBNumberCB0112349
- MFC6H14N2O7
- MW226.18
- EINECS221-146-3
- MDL NumberMFCD00013068
- MOL File3012-65-5.mol
Chemical Properties
| Melting point: | 185 °C (dec.)(lit.) |
| Boiling point: | 100 °C(lit.) |
| bulk density | 400-600kg/m3 |
| Density | 1.22 g/mL at 20 °C |
| vapor density | 1.8 (vs air) |
| refractive index | 1.4650 (estimate) |
| storage temp. | Store at +5°C to +30°C. |
| solubility | H2O: 1 M at 20 °C, clear, colorless |
| form | Solid |
| color | White |
| PH | 5.48(1 mM solution);5.29(10 mM solution);5.04(100 mM solution);6.16(1000 mM solution) |
| Odor | Slight ammonia odor |
| PH Range | 5.2 |
| Water Solubility | Soluble in water. Slightiy soluble in alcohol. |
| λmax | λ: 260 nm Amax: ≤0.05 λ: 280 nm Amax: ≤0.03 |
| Merck | 14,512 |
| BRN | 4925760 |
| Stability: | Stable. |
| Cosmetics Ingredients Functions | BUFFERING CHELATING |
| Cosmetic Ingredient Review (CIR) | Ammonium citrate dibasic (3012-65-5) |
| InChI | 1S/C6H8O7.2H3N/c7-3(8)1-6(13,5(11)12)2-4(9)10;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);2*1H3 |
| InChIKey | YXVFQADLFFNVDS-UHFFFAOYSA-N |
| SMILES | N.N.OC(=O)CC(O)(CC(O)=O)C(O)=O || N.N.OC(=O)CC(O)(CC(O)=O)C(O)=O |
| LogP | -2.840 |
| CAS DataBase Reference | 3012-65-5(CAS DataBase Reference) |
| EPA Substance Registry System | Diammonium citrate (3012-65-5) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319 | |||||||||
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 | |||||||||
| PPE | dust mask type N95 (US), Eyeshields, Gloves | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38-36/37 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | UN 9087 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | GE7545000 | |||||||||
| F | 8 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 9 | |||||||||
| HS Code | 29181500 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 |
|||||||||
| Hazardous Substances Data | 3012-65-5(Hazardous Substances Data) | |||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|