5-Chloro-2-methylbenzoic acid
- Product Name5-Chloro-2-methylbenzoic acid
- CAS7499-06-1
- CBNumberCB9710584
- MFC8H7ClO2
- MW170.59
- MDL NumberMFCD00045842
- MOL File7499-06-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 168-173 °C |
| Boiling point | 293.5±20.0 °C(Predicted) |
| Density | 1.310±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.50±0.25(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C8H7ClO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | CSAPESWNZDOAFU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=CC=C1C |
| CAS DataBase Reference | 7499-06-1(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H315-H318-H335 | |||||||||
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-41-37/38-22 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
