2-Methyl-3-nitrophenol
- Product Name2-Methyl-3-nitrophenol
- CAS5460-31-1
- CBNumberCB9300378
- MFC7H7NO3
- MW153.14
- EINECS226-739-0
- MDL NumberMFCD00007241
- MOL File5460-31-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 146-148 °C (lit.) |
| Boiling point | 147.0-152.0°C |
| Density | 1.2744 (estimate) |
| refractive index | 1.5744 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 95% ethanol: soluble50mg/mL |
| pka | 9.11±0.25(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown to Dark green |
| BRN | 1946057 |
| InChI | InChI=1S/C7H7NO3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3 |
| InChIKey | GAKLFAZBKQGUBO-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC([N+]([O-])=O)=C1C |
| CAS DataBase Reference | 5460-31-1(CAS DataBase Reference) |
| FDA UNII | XL5HG597X2 |
| NIST Chemistry Reference | 3-Nitro-o-cresol(5460-31-1) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36/37-36/37/39-36-24/25 | |||||||||
| RIDADR | UN 2446 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10 | |||||||||
| Hazard Note | Harmful | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29089000 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
