4-Ethylphenylboronic acid
- Product Name4-Ethylphenylboronic acid
- CAS63139-21-9
- CBNumberCB9204908
- MFC8H11BO2
- MW149.98
- EINECS613-145-5
- MDL NumberMFCD00859377
- MOL File63139-21-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 150-155 °C (lit.) |
| Boiling point | 285.1±33.0 °C(Predicted) |
| Density | 1.125 g/cm3 (20℃) |
| vapor pressure | 0-0Pa at 20-50℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 1.2g/l |
| pka | 8.87±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| BRN | 3030638 |
| InChI | InChI=1S/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3 |
| InChIKey | RZCPLOMUUCFPQA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(CC)C=C1)(O)O |
| LogP | 2.8 at 25℃ and pH3.5 |
| Surface tension | 50mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 63139-21-9(CAS DataBase Reference) |
| UNSPSC Code | 12352103 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 36/37/38-22 | |||||||||
| Safety Statements | 37/39-26-36/37 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 | |||||||||
| NFPA 704: |
|
