3-Methoxy-2-methylbenzoic acid
- Product Name3-Methoxy-2-methylbenzoic acid
- CAS55289-06-0
- CBNumberCB8449436
- MFC9H10O3
- MW166.17
- EINECS1533716-785-6
- MDL NumberMFCD02094039
- MOL File55289-06-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 147.0 to 151.0 °C |
| Boiling point | 138 °C(Press: 16 Torr) |
| Density | 1.168±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.83±0.10(Predicted) |
| color | White to Yellow to Orange |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| BRN | 510395 |
| InChI | InChI=1S/C9H10O3/c1-6-7(9(10)11)4-3-5-8(6)12-2/h3-5H,1-2H3,(H,10,11) |
| InChIKey | JPCISVSOTKMFPG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(OC)=C1C |
| CAS DataBase Reference | 55289-06-0(CAS DataBase Reference) |
| UNSPSC Code | 12352106 |
| NACRES | NA.21 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | WGK 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2916399090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|
