Butyltrimethylammonium bis(trifluoromethylsulfonyl)imide
- Product NameButyltrimethylammonium bis(trifluoromethylsulfonyl)imide
- CAS258273-75-5
- CBNumberCB82469780
- MFC7H18N.C2F6NO4S2
- MW396.371
- MDL NumberMFCD12761449
- MOL File258273-75-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 17°C(lit.) |
| Density | 1.3966 g/cm3(Temp: 19.82 °C) |
| refractive index | 1.4080 to 1.4120 |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Viscosity | 99.5 cP |
| BRN | 9971934 |
| InChI | InChI=1S/C7H18N.C2F6NO4S2/c1-5-6-7-8(2,3)4;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-7H2,1-4H3;/q+1;-1 |
| InChIKey | XSGKJXQWZSFJEJ-UHFFFAOYSA-N |
| SMILES | [N+](C)(C)(CCCC)C.[N-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| ECW | 6.1 V |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301+H311-H314 | |||||||||
| Precautionary statements | P270-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P361+P364 | |||||||||
| Hazard Codes | T,N | |||||||||
| Risk Statements | 24/25-34-51/53 | |||||||||
| Safety Statements | 26-36/37/39-45-61 | |||||||||
| RIDADR | UN 2922 6.1(8) / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2935.90.9500 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Skin Corr. 1B | |||||||||
| NFPA 704: |
|
