Methyl vinyl ether-monoethyl maleate copolymer
- Product NameMethyl vinyl ether-monoethyl maleate copolymer
- CAS25087-06-3
- CBNumberCB8225722
- MFC9H14O5
- MW202.21
- MDL NumberMFCD00134020
- MOL File25087-06-3.mol
- MSDS FileSDS
Chemical Properties
| Density | 0.983 g/mL at 25 °C |
| refractive index | n |
| Flash point | 48 °F |
| form | liquid |
| Cosmetics Ingredients Functions | ANTISTATIC HAIR FIXING FILM FORMING |
| Cosmetic Ingredient Review (CIR) | METHYL VINYL ETHER-MONOETHYL MALEATE COPOLYMER (25087-06-3) |
| InChI | 1S/C6H8O4.C3H6O/c1-2-10-6(9)4-3-5(7)8;1-3-4-2/h3-4H,2H2,1H3,(H,7,8);3H,1H2,2H3/b4-3-; |
| InChIKey | UVHQXWILFGUDTA-LNKPDPKZSA-N |
| SMILES | COC=C.CCOC(=O)\C=C\C(O)=O |
| LogP | 0.287 (est) |
| EPA Substance Registry System | 2-Butenedioic acid (2Z)-, 1-ethyl ester, polymer with methoxyethene (25087-06-3) |
| UNSPSC Code | 12162002 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
![]()
|
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P280-P304+P340+P312-P305+P351+P338-P337+P313-P403+P235 |
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38-41 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1866 3/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | rat,LD50,oral,> 25600mg/kg (25600mg/kg),Journal of the American College of Toxicology. Vol. 12(3), Pg. 243, 1993. |
