3,5-Bis(trifluoromethyl)benzoyl chloride
- Product Name3,5-Bis(trifluoromethyl)benzoyl chloride
- CAS785-56-8
- CBNumberCB7724420
- MFC9H3ClF6O
- MW276.56
- EINECS212-322-0
- MDL NumberMFCD00000387
- MOL File785-56-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 5-10C |
| Boiling point | 65-67 °C (12 mmHg) |
| Density | 1.526 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 162 °F |
| storage temp. | Store at room temperature, keep dry and cool |
| form | Liquid |
| Specific Gravity | 1.526 (20/4℃) |
| color | Clear colorless to very slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2593440 |
| InChI | 1S/C9H3ClF6O/c10-7(17)4-1-5(8(11,12)13)3-6(2-4)9(14,15)16/h1-3H |
| InChIKey | WAKMMQSMEDJRRI-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)C(Cl)=O |
| CAS DataBase Reference | 785-56-8(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-37-36 | |||||||||
| Safety Statements | 26-36/37/39-45-27 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-19-21 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|
