N-Benzyliminodiacetic acid
- Product NameN-Benzyliminodiacetic acid
- CAS3987-53-9
- CBNumberCB7682157
- MFC11H13NO4
- MW223.23
- EINECS223-631-5
- MDL NumberMFCD00004285
- MOL File3987-53-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 200-202 °C (dec.)(lit.) |
| Boiling point | 420.9±35.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | very faint turbidity in hot Water |
| form | powder to crystal |
| pka | 1.77±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C11H13NO4/c13-10(14)7-12(8-11(15)16)6-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,13,14)(H,15,16) |
| InChIKey | SZQUPQVVCLFZLC-UHFFFAOYSA-N |
| SMILES | OC(=O)CN(CC(O)=O)Cc1ccccc1 |
| CAS DataBase Reference | 3987-53-9(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2922.49.8000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|