Gallium(III) 2,4-pentanedionate
- Product NameGallium(III) 2,4-pentanedionate
- CAS14405-43-7
- CBNumberCB7674789
- MFC15H21GaO6
- MW367.05
- EINECS238-377-0
- MDL NumberMFCD00013492
- MOL File14405-43-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 196-198 °C (dec.)(lit.) |
| Boiling point | 140°C 10mm |
| Density | 1,42 g/cm3 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Powder |
| Specific Gravity | 1.42 |
| color | white to pale yellow |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/3C5H8O2.Ga/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; |
| InChIKey | ZVYYAYJIGYODSD-LNTINUHCSA-K |
| SMILES | [Ga](O/C(/C)=C\C(=O)C)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 | |||||||||
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38-40 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | No | |||||||||
| HS Code | 2914199090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
