Potassium hexacyanocobaltate(III)
- Product NamePotassium hexacyanocobaltate(III)
- CAS13963-58-1
- CBNumberCB7334568
- MFC6CoKN6(-2)
- MW254.14
- EINECS237-742-1
- MDL NumberMFCD00011391
- MOL File13963-58-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | decomposes, forming olive green mass [MER06] |
| Density | 1.878 g/mL at 25 °C (lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | very soluble in H2O; insoluble in ethanol |
| form | Crystalline Solid |
| color | Slightly yellow to light brown |
| Specific Gravity | 1.906 |
| Water Solubility | soluble |
| Sensitive | Light Sensitive |
| Merck | 14,7637 |
| Exposure limits | ACGIH: TWA 0.02 mg/m3 NIOSH: IDLH 25 mg/m3 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/6CN.Co.K/c6*1-2;;/q6*-1;+3;+1 |
| InChIKey | DCWJDZBCZORDFX-UHFFFAOYSA-N |
| SMILES | [Co+3]([C-]#N)([C-]#N)([C-]#N)([C-]#N)([C-]#N)[C-]#N.[K+] |
| CAS DataBase Reference | 13963-58-1(CAS DataBase Reference) |
| FDA UNII | P3AF0UWR0Y |
| EPA Substance Registry System | Cobaltate(3-), hexakis(cyano-.kappa.C)-, tripotassium, (OC-6-11)- (13963-58-1) |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H317-H351-H302 | |||||||||
| Precautionary statements | P301+P312+P330-P201-P261-P280-P301+P312a-P405-P501a | |||||||||
| Hazard Codes | T,Xn | |||||||||
| Risk Statements | 23/24/25-33-32-22 | |||||||||
| Safety Statements | 28-36/37-45-7/9-24/25 | |||||||||
| RIDADR | UN 1588 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | GF9470000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 28419000 | |||||||||
| Storage Class | 13 - Non Combustible Solids | |||||||||
| Toxicity | mouse,LD50,oral,1529mg/kg (1529mg/kg),Journal of Pharmaceutical Sciences. Vol. 52, Pg. 59, 1963. | |||||||||
| NFPA 704: |
|
