N,N'-Difluoro-2,2'-bipyridinium bis(tetrafluoroborate)
- Product NameN,N'-Difluoro-2,2'-bipyridinium bis(tetrafluoroborate)
- CAS178439-26-4
- CBNumberCB7305834
- MFC10H8BF6N2+
- MW280.99
- MDL NumberMFCD01073546
- MOL File178439-26-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 175 °C (dec.)(lit.) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | 1S/C10H8F2N2.2BF4/c11-13-7-3-1-5-9(13)10-6-2-4-8-14(10)12;2*2-1(3,4)5/h1-8H;;/q+2;2*-1 |
| InChIKey | IDFABAACDRPWQX-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.F[B-](F)(F)F.F[n+]1ccccc1-c2cccc[n+]2F |
| CAS DataBase Reference | 178439-26-4(CAS DataBase Reference) |
| UNSPSC Code | 12352101 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H314 | |||||||||
| Precautionary statements | P260-P264-P270-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501-P280-P305+P351+P338-P310 | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 22-34 | |||||||||
| Safety Statements | 26-27-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | CORROSIVE | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29335995 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
