4-Nitropyrrole-2-carboxylic acid ethyl ester
- Product Name4-Nitropyrrole-2-carboxylic acid ethyl ester
- CAS5930-92-7
- CBNumberCB7240498
- MFC7H8N2O4
- MW184.15
- MDL NumberMFCD00059927
- MOL File5930-92-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 174°C |
| Boiling point | 347.7±22.0 °C(Predicted) |
| Density | 1.374 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 12.21±0.50(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C7H8N2O4/c1-2-13-7(10)6-3-5(4-8-6)9(11)12/h3-4,8H,2H2,1H3 |
| InChIKey | PEORWHVRWXGKMS-UHFFFAOYSA-N |
| SMILES | N1C=C([N+]([O-])=O)C=C1C(OCC)=O |
| UNSPSC Code | 12352200 |
| NACRES | NA.21 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H318 | |||||||||
| Precautionary statements | P280-P305+P351+P338+P310 | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | 1325 | |||||||||
| WGK Germany | WGK 3 | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2933998090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Dam. 1 | |||||||||
| NFPA 704: |
|
