3-Acetylpyridine adenine dinucleotide
- Product Name3-Acetylpyridine adenine dinucleotide
- CAS86-08-8
- CBNumberCB6733207
- MFC22H28N6O14P2
- MW662.44
- EINECS201-649-4
- MDL NumberMFCD00078882
- MOL File86-08-8.mol
- MSDS FileSDS
Chemical Properties
| storage temp. | −20°C |
| solubility | PBS (pH 7.2): 10 mg/ml |
| form | A crystalline solid |
| color | White to light yellow |
| biological source | Porcine brain |
| Water Solubility | water: 50mg/mL, clear, colorless to faintly yellow |
| InChIKey | KPVQNXLUPNWQHM-MFRNWTRNNA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP([O-])(=O)OC[C@@H]2[C@H]([C@@H](O)[C@H]([N+]3=CC=CC(C(=O)C)=C3)O2)O)O[C@H]1N1C=NC2C(=NC=NC1=2)N)O |&1:1,2,3,15,16,17,19,32,r| |
| UNSPSC Code | 41106305 |
| NACRES | NA.51 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P271-P261-P280 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2934999090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|