Cyclopropyldiphenylsulfonium tetrafluoroborate
- Product NameCyclopropyldiphenylsulfonium tetrafluoroborate
- CAS33462-81-6
- CBNumberCB6488927
- MFC15H15BF4S
- MW314.15
- EINECS251-530-6
- MDL NumberMFCD00011873
- MOL File33462-81-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 136-138 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | a suspension in THF, DME, DMSO, MeCN |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 4172245 |
| InChI | InChI=1S/C15H15S.BF4/c1-3-7-13(8-4-1)16(15-11-12-15)14-9-5-2-6-10-14;2-1(3,4)5/h1-10,15H,11-12H2;/q+1;-1 |
| InChIKey | DWEYKSWKFYZEGZ-UHFFFAOYSA-N |
| SMILES | [S+](C1C=CC=CC=1)(C1=CC=CC=C1)C1CC1.[B-](F)(F)(F)F |
| CAS DataBase Reference | 33462-81-6(CAS DataBase Reference) |
| UNSPSC Code | 12352200 |
| NACRES | NA.21 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| RIDADR | 1759 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|