2,4-Di-tert-amylphenol
- Product Name2,4-Di-tert-amylphenol
- CAS120-95-6
- CBNumberCB6286516
- MFC16H26O
- MW234.38
- EINECS204-439-0
- MDL NumberMFCD00041929
- MOL File120-95-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 25 °C (lit.) |
| Boiling point | 169-170 °C/22 mmHg (lit.) |
| Density | 0.930 g/mL at 25 °C (lit.) |
| refractive index | 1.506-1.508 |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| pka | 11.00±0.31(Predicted) |
| form | powder to lump to clear liquid |
| color | White or Colorless to Almost white or Almost colorless |
| Viscosity | 208mm2/s |
| Water Solubility | 3mg/L at 21℃ |
| InChI | InChI=1S/C16H26O/c1-7-15(3,4)12-9-10-14(17)13(11-12)16(5,6)8-2/h9-11,17H,7-8H2,1-6H3 |
| InChIKey | WMVJWKURWRGJCI-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C(C)(C)CC)C=C1C(C)(C)CC |
| LogP | 6.3 at 22℃ |
| CAS DataBase Reference | 120-95-6(CAS DataBase Reference) |
| EWG's Food Scores | 2 |
| FDA UNII | 852F1HP88H |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H371-H410-H302-H319 | |||||||||
| Precautionary statements | P260-P264-P270-P273-P280-P301+P312+P330-P305+P351+P338+P337+P313-P308+P311-P391-P405-P501-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 22-36-36/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| RIDADR | 3077 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | SL3500000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29071990 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 | |||||||||
| Hazardous Substances Data | 120-95-6(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|
