Protriptyline hydrochloride
- Product NameProtriptyline hydrochloride
- CAS1225-55-4
- CBNumberCB6248396
- MFC19H22ClN
- MW299.84
- EINECS214-956-3
- MDL NumberMFCD00072057
- MOL File1225-55-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 169-171° |
| Flash point | 9℃ |
| storage temp. | 2-8°C |
| solubility | H2O: soluble50mg/mL |
| pka | 8.2(at 25℃) |
| form | powder |
| color | white to off-white |
| Water Solubility | H2O: 50mg/mL |
| Stability | Hygroscopic |
| InChI | InChI=1S/C19H21N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3;1H |
| InChIKey | OGQDIIKRQRZXJH-UHFFFAOYSA-N |
| SMILES | C1(CCCNC)C2C=CC=CC=2C=CC2C=CC=CC1=2.Cl |
| FDA UNII | 44665V00O8 |
| UNSPSC Code | 41116107 |
| NACRES | NA.77 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,T,F | |||||||||
| Risk Statements | 20/21/22-36/37/38-39/23/24/25-23/24/25-11 | |||||||||
| Safety Statements | 26-36-45-36/37-16-7 | |||||||||
| RIDADR | 3249 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | HP1400000 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2921490002 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| Toxicity | dog,LDLo,oral,400mg/kg (400mg/kg),"Psychotropic Drugs and Related Compounds," 2nd ed., Usdin, E., and D.H. Efron, Washington, DC, 1972Vol. -, Pg. 88, 1972. | |||||||||
| NFPA 704: |
|
