| Melting point |
219-221 °C(lit.) |
| Boiling point |
222°C |
| Density |
0.887 |
| vapor pressure |
0.002-1850Pa at 25℃ |
| Flash point |
65°C |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
pyridine: soluble100mg/mL, clear to slightly hazy, colorless to light yellow |
| form |
solid |
| pka |
16.51±0.46(Predicted) |
| color |
White to Almost white |
| Water Solubility |
Reacts with water. |
| Hydrolytic Sensitivity |
7: reacts slowly with moisture/water |
| Sensitive |
Moisture Sensitive |
| BRN |
1937452 |
| InChI |
1S/C7H20N2OSi2/c1-11(2,3)8-7(10)9-12(4,5)6/h1-6H3,(H2,8,9,10) |
| InChIKey |
MASDFXZJIDNRTR-UHFFFAOYSA-N |
| SMILES |
C[Si](C)(C)NC(=O)N[Si](C)(C)C |
| LogP |
-2.11-2.72 at 20℃ |
| CAS DataBase Reference |
18297-63-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Urea, n,n'-bis(trimethylsilyl)-(18297-63-7) |
| EPA Substance Registry System |
N,N'-Bis(trimethylsilyl)urea (18297-63-7) |
| UNSPSC Code |
12352100 |
| NACRES |
NA.22 |