Aluminum tert-butoxide
- Product NameAluminum tert-butoxide
- CAS556-91-2
- CBNumberCB5682825
- MFC12H27AlO3
- MW246.32
- EINECS209-146-1
- MDL NumberMFCD00008801
- MOL File556-91-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 241°C |
| Boiling point | 156°C 2mm |
| Density | 1,0251 g/cm3 |
| Flash point | >65°C |
| solubility | Very soluble in organic solvents like alcohols, benzene, toluene and xylene. |
| form | Powder |
| color | White to Gray |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Moisture Sensitive |
| Merck | 14,333 |
| BRN | 4148229 |
| Stability | Stable, but air and moisture sensitive. Incompatible with acids, strong oxidizing agents. Highly flammable. |
| InChI | 1S/3C4H9O.Al/c3*1-4(2,3)5;/h3*1-3H3;/q3*-1;+3 |
| InChIKey | MDDPTCUZZASZIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)O[Al](OC(C)(C)C)OC(C)(C)C |
| CAS DataBase Reference | 556-91-2(CAS DataBase Reference) |
| FDA UNII | 6D623JMP3R |
| EPA Substance Registry System | 2-Propanol, 2-methyl-, aluminum salt (556-91-2) |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H314 | |||||||||
| Precautionary statements | P210-P240-P260-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| Hazard Codes | F,C | |||||||||
| Risk Statements | 11-34 | |||||||||
| Safety Statements | 8-16-26-36/37/39-45 | |||||||||
| RIDADR | UN 2925 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29051990 | |||||||||
| Storage Class | 4.1B - Flammable solid hazardous materials | |||||||||
| Hazard Classifications | Flam. Sol. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
