4-Phenoxybenzylamine
- Product Name4-Phenoxybenzylamine
- CAS107622-80-0
- CBNumberCB5496424
- MFC13H13NO
- MW199.25
- MDL NumberMFCD01310836
- MOL File107622-80-0.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 138°C 5mm |
| Density | 1,12 g/cm3 |
| refractive index | 1.59 |
| Flash point | 150℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO |
| form | clear liquid |
| pka | 9.13±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C13H13NO/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12/h1-9H,10,14H2 |
| InChIKey | CCAZAGUSBMVSAR-UHFFFAOYSA-N |
| SMILES | C1(CN)=CC=C(OC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 107622-80-0(CAS DataBase Reference) |
| UNSPSC Code | 12352116 |
Safety
| Symbol(GHS) |
![]() ![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H315-H318-H335-H410 | |||||||||
| Precautionary statements | P261-P273-P280-P301+P310-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | C,Xi,N,T | |||||||||
| Risk Statements | 36/37/38-50-41-37/38-25 | |||||||||
| Safety Statements | 26-36/37/39-61-45-39 | |||||||||
| RIDADR | UN 2811 6.1 / PGIII | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT, IRRITANT-HARMFUL | |||||||||
| HS Code | 2922290090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|

