4-Chloropyridine N-oxide
- Product Name4-Chloropyridine N-oxide
- CAS1121-76-2
- CBNumberCB5232071
- MFC5H4ClNO
- MW129.54
- EINECS214-336-2
- MDL NumberMFCD00047425
- MOL File1121-76-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 160 °C (dec.) (lit.) |
| Boiling point | 310.0±15.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 0+-.0.10(Predicted) |
| color | White to Light yellow to Light orange |
| InChI | InChI=1S/C5H4ClNO/c6-5-1-3-7(8)4-2-5/h1-4H |
| InChIKey | DPJVRASYWYOFSJ-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C(Cl)C=1 |
| CAS DataBase Reference | 1121-76-2(CAS DataBase Reference) |
| FDA UNII | F3196UEB9Q |
| NIST Chemistry Reference | 4-Chloropyridine-N-oxide(1121-76-2) |
| EPA Substance Registry System | 4-Chloropyridine 1-oxide (1121-76-2) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-20/21/22 | |||||||||
| Safety Statements | 26-37/39-36/37/39-36 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29333999 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
