Silanamine, 1,1,1-trimethyl-N-(trimethylsilyl)-, hydrolysis products with silica
- Product NameSilanamine, 1,1,1-trimethyl-N-(trimethylsilyl)-, hydrolysis products with silica
- CAS68909-20-6
- CBNumberCB5199392
- MFC6H19NO2Si3
- MW221.48
- EINECS272-697-1
- MDL NumberMFCD00011232
- MOL File68909-20-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 1610 °C(lit.) |
| Boiling point | >100 °C(lit.) |
| Density | 2.6 g/mL at 25 °C(lit.) |
| refractive index | n |
| storage temp. | 2-8°C |
| form | tablets (~0.5 g each) |
| Specific Gravity | 2.2 |
| color | White with some blue indicating granules |
| Hydrolytic Sensitivity | 5: forms reversible hydrate |
| Dielectric constant | 2.5-3.5(0.0℃) |
| Major Application | glass & ceramic industrial qc pharmaceutical |
| InChI | InChI=1S/C6H19NSi2.O2Si/c1-8(2,3)7-9(4,5)6;1-3-2/h7H,1-6H3; |
| InChIKey | SVOGQRMBDCQOJU-UHFFFAOYSA-N |
| SMILES | N([Si](C)(C)C)[Si](C)(C)C.[Si](=O)=O |
| EPA Substance Registry System | Hydrolysis products of 1,1,1-trimethyl-N-(trimethylsilyl)silanamine with silica (68909-20-6) |
| UNSPSC Code | 41116107 |
| NACRES | NC.07 |
Safety
| Symbol(GHS) |
|
| Signal word | Danger |
| Hazard statements | H373 |
| Precautionary statements | P260-P314-P501 |
| Hazard Codes | Xn |
| Risk Statements | 48/20 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | VV7340000 |
| F | 3 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |