Diphenyliodonium nitrate
- Product NameDiphenyliodonium nitrate
- CAS722-56-5
- CBNumberCB4760296
- MFC12H10INO3
- MW343.12
- EINECS211-962-8
- MDL NumberMFCD00031704
- MOL File722-56-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 150-154 °C (lit.) |
| Density | 1.7164 (estimate) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Soluble in hot water |
| Sensitive | Light Sensitive |
| λmax | 203 nm 226 nm (2nd) |
| BRN | 3922747 |
| InChI | InChI=1S/C12H10I.NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2-1(3)4/h1-10H;/q+1;-1 |
| InChIKey | CQZCVYWWRJDZBO-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)[I+]C1=CC=CC=C1.[N+]([O-])([O-])=O |
| CAS DataBase Reference | 722-56-5(CAS DataBase Reference) |
| UNSPSC Code | 12352300 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H272 | |||||||||
| Precautionary statements | P220 | |||||||||
| Hazard Codes | O | |||||||||
| Risk Statements | 8 | |||||||||
| Safety Statements | 17-24/25 | |||||||||
| RIDADR | UN 1479 5.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NN6665000 | |||||||||
| F | 8-10 | |||||||||
| HazardClass | 5.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29319090 | |||||||||
| Storage Class | 5.1B - Oxidizing hazardous materials | |||||||||
| Hazard Classifications | Ox. Sol. 2 | |||||||||
| NFPA 704: |
|
