4-Benzyloxy-3-chlorophenylboronic acid
- Product Name4-Benzyloxy-3-chlorophenylboronic acid
- CAS845551-44-2
- CBNumberCB4741419
- MFC13H12BClO3
- MW262.5
- MDL NumberMFCD04115642
- MOL File845551-44-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 188-193 °C (lit.) |
| Boiling point | 450.2±55.0 °C(Predicted) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 7.67±0.17(Predicted) |
| color | White to Almost white |
| InChI | 1S/C13H12BClO3/c15-12-8-11(14(16)17)6-7-13(12)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2 |
| InChIKey | AYSMMNDQVZAXQY-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(OCc2ccccc2)c(Cl)c1 |
| CAS DataBase Reference | 845551-44-2(CAS DataBase Reference) |
| UNSPSC Code | 12352103 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29310095 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|