| Melting point |
193 °C (dec.)(lit.) |
| Boiling point |
472.9±45.0 °C(Predicted) |
| Density |
1.367±0.06 g/cm3(Predicted) |
| Flash point |
87°(189°F) |
| storage temp. |
Keep in dark place,Sealed in dry,2-8°C |
| solubility |
Soluble in acetone and dimethyl sulfoxide. |
| pka |
4.22±0.10(Predicted) |
| form |
Solid |
| color |
White to Off-White |
| ex/em |
λex 323 nm; λem 382 nm in MeOH |
| Stability |
Moisture, Temperature, Light Sensitive |
| InChI |
InChI=1S/C12H10O5/c1-16-8-2-3-9-7(4-11(13)14)5-12(15)17-10(9)6-8/h2-3,5-6H,4H2,1H3,(H,13,14) |
| InChIKey |
ZEKAXIFHLIITGV-UHFFFAOYSA-N |
| SMILES |
C1(=O)OC2=CC(OC)=CC=C2C(CC(O)=O)=C1 |
| CAS DataBase Reference |
62935-72-2(CAS DataBase Reference) |
| UNSPSC Code |
12352100 |
| NACRES |
NA.22 |