Tris(N N-bis(trimethylsilyl)amide)gado&
- Product NameTris(N N-bis(trimethylsilyl)amide)gado&
- CAS35789-03-8
- CBNumberCB4499741
- MFC18H54GdN3Si6
- MW638.412
- MDL NumberMFCD03427091
- MOL File35789-03-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 67-90 °C(lit.) |
| Flash point | 36 °F |
| form | solid |
| Water Solubility | Soluble in water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| InChI | 1S/3C6H18NSi2.Gd/c3*1-8(2,3)7-9(4,5)6;/h3*1-6H3;/q3*-1;+3 |
| InChIKey | LFWPRLGQJJEPDP-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N([Gd](N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H228-H261-H314 | |||||||||
| Precautionary statements | P210-P231+P232-P260-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| Hazard Codes | F,C | |||||||||
| Risk Statements | 11-14/15-34 | |||||||||
| Safety Statements | 16-26-36/37/39-43-45-7/8 | |||||||||
| RIDADR | UN 3396 4.3/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 4.1 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | |||||||||
| Hazard Classifications | Flam. Sol. 1 Skin Corr. 1B Water-react 2 | |||||||||
| NFPA 704: |
|
