![3-Chlorobenzo[b]thiophene-2-carbonyl chloride Structure](https://www.chemicalbook.com/CAS/GIF/21815-91-8.gif)
3-Chlorobenzo[b]thiophene-2-carbonyl chloride
- Product Name3-Chlorobenzo[b]thiophene-2-carbonyl chloride
- CAS21815-91-8
- CBNumberCB4481555
- MFC9H4Cl2OS
- MW231.1
- EINECS625-793-6
- MDL NumberMFCD00053069
- MOL File21815-91-8.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 112-116 °C |
| Boiling point | 342.2±22.0 °C(Predicted) |
| Density | 1.526±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1309703 |
| InChI | InChI=1S/C9H4Cl2OS/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H |
| InChIKey | GWKSSMDJEWPKCM-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1SC2=CC=CC=C2C=1Cl)=O |
| CAS DataBase Reference | 21815-91-8(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H290-H318-H314 | |||||||||
| Precautionary statements | P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P501a-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B | |||||||||
| NFPA 704: |
|
