2',3',4'-Trihydroxyacetophenone
- Product Name2',3',4'-Trihydroxyacetophenone
- CAS528-21-2
- CBNumberCB4360104
- MFC8H8O4
- MW168.15
- EINECS208-430-2
- MDL NumberMFCD00002193
- MOL File528-21-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 169-172 °C(lit.) |
| Boiling point | 257.07°C (rough estimate) |
| Density | 1.3037 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Storage temp. 2-8°C |
| form | powder to crystal |
| pka | 7.81±0.23(Predicted) |
| color | White to Orange to Green |
| Merck | 14,4342 |
| InChI | InChI=1S/C8H8O4/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-3,10-12H,1H3 |
| InChIKey | XIROXSOOOAZHLL-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(O)C(O)=C1O)C |
| CAS DataBase Reference | 528-21-2(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | C70E921C4P |
| NIST Chemistry Reference | Ethanone, 1-(2,3,4-trihydroxyphenyl)-(528-21-2) |
| EPA Substance Registry System | Ethanone, 1-(2,3,4-trihydroxyphenyl)- (528-21-2) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | AN0527000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29145090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|

