Diethyl 2,4-dimethylpyrrole-3,5-dicarboxylate
- Product NameDiethyl 2,4-dimethylpyrrole-3,5-dicarboxylate
- CAS2436-79-5
- CBNumberCB4294748
- MFC12H17NO4
- MW239.27
- EINECS219-431-2
- MDL NumberMFCD00005218
- MOL File2436-79-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 135-136 °C(lit.) |
| Boiling point | 381.93°C (rough estimate) |
| Density | 1.1724 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 14.69±0.50(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C12H17NO4/c1-5-16-11(14)9-7(3)10(13-8(9)4)12(15)17-6-2/h13H,5-6H2,1-4H3 |
| InChIKey | XSBSXJAYEPDGSF-UHFFFAOYSA-N |
| SMILES | N1C(C)=C(C(OCC)=O)C(C)=C1C(OCC)=O |
| LogP | 3.850 (est) |
| CAS DataBase Reference | 2436-79-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-Pyrrole-2,4-dicarboxylic acid, 3,5-dimethyl-, diethyl ester(2436-79-5) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 24/25 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HS Code | 29339900 | |||||||||
| NFPA 704: |
|
