2,3,6-Trifluorobenzoic acid
- Product Name2,3,6-Trifluorobenzoic acid
- CAS2358-29-4
- CBNumberCB4103376
- MFC7H3F3O2
- MW176.09
- MDL NumberMFCD00002409
- MOL File2358-29-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 130-131 °C (lit.) |
| Boiling point | 233.5±35.0 °C(Predicted) |
| Density | 1.536±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.00±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2579153 |
| InChI | InChI=1S/C7H3F3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H,11,12) |
| InChIKey | MGUPHQGQNHDGNK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C=CC(F)=C1F |
| CAS DataBase Reference | 2358-29-4(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-37/39-36 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 29163990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
