(S,S)-(+)-N,N'-Bis(3,5-di-tert-butylsalicylidene)-1,2-cyclohexanediamine
- Product Name(S,S)-(+)-N,N'-Bis(3,5-di-tert-butylsalicylidene)-1,2-cyclohexanediamine
- CAS135616-36-3
- CBNumberCB3397509
- MFC36H54N2O2
- MW546.83
- MDL NumberMFCD00191801
- MOL File135616-36-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 203-206 °C(lit.) |
| alpha | +305° (c 1, CH2Cl2) |
| Boiling point | 619.74°C (rough estimate) |
| Density | 1.0110 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 13.06±0.40(Predicted) |
| form | Powder |
| color | yellow |
| optical activity | [α]20/D +315 to 15°, c = 1 in methylene chloride |
| BRN | 5464823 |
| InChIKey | FYNXDGNCEBQLGC-GTHUDTLPSA-N |
| SMILES | [C@H]1(/N=C/C2=CC(C(C)(C)C)=CC(C(C)(C)C)=C2O)CCCC[C@@H]1/N=C/C1=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O |
| UNSPSC Code | 12352116 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
(b) Formation of cyanohydrins from aldehydes.
(c) Desymmetrization of meso-epoxides with azide.
(d) Hetero Diels-Alder reaction.
(e) Nozaki-Hiyama reaction.
(f) Reagent used for the Passerini, three-component reaction.

