4-Methylphenyl isothiocyanate
- Product Name4-Methylphenyl isothiocyanate
- CAS622-59-3
- CBNumberCB3252639
- MFC8H7NS
- MW149.21
- EINECS210-745-5
- MDL NumberMFCD00004813
- MOL File622-59-3.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 25-26 °C (lit.) |
| Boiling point | 237 °C (lit.) 62 °C/0.3 mmHg (lit.) |
| Density | 1.1442 (rough estimate) |
| refractive index | n |
| Flash point | 107 °C |
| storage temp. | Store below +30°C. |
| form | powder to lump |
| color | White to Light yellow |
| Water Solubility | MAY DECOMPOSE |
| Sensitive | Moisture Sensitive |
| BRN | 386032 |
| InChI | InChI=1S/C8H7NS/c1-7-2-4-8(5-3-7)9-6-10/h2-5H,1H3 |
| InChIKey | ABQKHKWXTUVKGF-UHFFFAOYSA-N |
| SMILES | C1(N=C=S)=CC=C(C)C=C1 |
| CAS DataBase Reference | 622-59-3(CAS DataBase Reference) |
| FDA UNII | 43U6A59KGV |
| NIST Chemistry Reference | Benzene, 1-isothiocyanato-4-methyl-(622-59-3) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H315-H317-H319-H334-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,T | |||||||||
| Risk Statements | 36/37/38-42-42/43-23/24/25 | |||||||||
| Safety Statements | 22-26-36-45-36/37/39 | |||||||||
| RIDADR | UN 2811 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NX9500000 | |||||||||
| F | 10-21 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29309090 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 | |||||||||
| NFPA 704: |
|
