n-Heptane-d16
- Product Namen-Heptane-d16
- CAS33838-52-7
- CBNumberCB2397946
- MFC7D16
- MW116.3
- EINECS680-746-7
- MDL NumberMFCD00062744
- MOL File33838-52-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -91 °C(lit.) |
| Boiling point | 98 °C(lit.) |
| Density | 0.794 g/mL at 25 °C(lit.) |
| vapor density | 3.5 (vs air) |
| vapor pressure | 40 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point | 30 °F |
| storage temp. | Flammables area |
| solubility | Difficult to mix. |
| form | Liquid |
| Sensitive | Hygroscopic |
| BRN | 1730763 |
| Stability | Stable. Incompatible with oxidizing agents. Highly flammable. Hygroscopic. |
| InChI | 1S/C7H16/c1-3-5-7-6-4-2/h3-7H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2 |
| InChIKey | IMNFDUFMRHMDMM-NEBSKJCTSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 33838-52-7(CAS DataBase Reference) |
| UNSPSC Code | 12142201 |
Safety
| Symbol(GHS) |
![]() ![]() ![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H225-H304-H315-H336-H410 | |||||||||
| Precautionary statements | P210-P233-P273-P301+P310-P303+P361+P353-P331 | |||||||||
| Hazard Codes | F | |||||||||
| Risk Statements | 11-67-65-50/53-38 | |||||||||
| Safety Statements | 9-16-23-29-33-62-61-60 | |||||||||
| RIDADR | UN1206 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | MI7700000 | |||||||||
| Autoignition Temperature | 595 °F | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 28459000 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|


