| Melting point |
>250°C |
| storage temp. |
room temp |
| solubility |
Solubility Soluble in water, ethanol |
| pka |
1.51, 8.32(at 25℃) |
| form |
Powder |
| color |
Orange-brown to black |
| PH Range |
1.2(red)-2.8(yellow) 7.4(yellow)-9(purple) |
| Water Solubility |
Soluble in water. |
| λmax |
436nm |
| ε(extinction coefficient) |
≥15000 at 433-439nm in H2O at 0.008g/L |
| Major Application |
Screening method of endocrine disrupting chemicals |
| InChI |
1S/C21H18O5S.Na/c1-13-11-15(22)7-9-17(13)21(18-10-8-16(23)12-14(18)2)19-5-3-4-6-20(19)27(24,25)26;/h3-12,22H,1-2H3,(H,24,25,26);/q;+1/p-1/b21-18+; |
| InChIKey |
BYQJYOOKENJSNK-GOSREXKOSA-M |
| SMILES |
[Na+].Cc1cc(O)ccc1\C(=C2\C=CC(=O)C=C2C)c3ccccc3S([O-])(=O)=O |
| CAS DataBase Reference |
62625-31-4 |
| EPA Substance Registry System |
Phenol, 4,4'-(2,2-dioxido-3H-1,2-benzoxathiol-3-ylidene)bis[3-methyl-, monosodium salt (62625-31-4) |
| UNSPSC Code |
12171500 |
| NACRES |
NA.47 |